C17H25N5 — CID 82544969
3-(aminomethyl)-2-(3-imidazol-1-ylpropyl)-N,N-dimethyl-1,3-dihydroisoindol-5-amine (PubChem CID 82544969) has the molecular formula C17H25N5 and a molecular weight of 299.42 g/mol. Its IUPAC name is 3-(aminomethyl)-2-(3-imidazol-1-ylpropyl)-N,N-dimethyl-1,3-dihydroisoindol-5-amine.
| Compound Name | 3-(aminomethyl)-2-(3-imidazol-1-ylpropyl)-N,N-dimethyl-1,3-dihydroisoindol-5-amine |
|---|---|
| PubChem CID | 82544969 |
| Molecular Formula | C17H25N5 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 3-(aminomethyl)-2-(3-imidazol-1-ylpropyl)-N,N-dimethyl-1,3-dihydroisoindol-5-amine |
| SMILES | CN(C)c1ccc2c(c1)C(CN)N(CCCn1ccnc1)C2 |
| InChI | InChI=1S/C17H25N5/c1-20(2)15-5-4-14-12-22(17(11-18)16(14)10-15)8-3-7-21-9-6-19-13-21/h4-6,9-10,13,17H,3,7-8,11-12,18H2,1-2H3 |
| InChIKey | YBPSUAWFGNYMHC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|