C11H13BrN2S — CID 82549434
6-bromo-N,4-diethyl-1,3-benzothiazol-2-amine (PubChem CID 82549434) has the molecular formula C11H13BrN2S and a molecular weight of 285.21 g/mol. Its IUPAC name is 6-bromo-N,4-diethyl-1,3-benzothiazol-2-amine.
| Compound Name | 6-bromo-N,4-diethyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82549434 |
| Molecular Formula | C11H13BrN2S |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 6-bromo-N,4-diethyl-1,3-benzothiazol-2-amine |
| SMILES | CCNc1nc2c(CC)cc(Br)cc2s1 |
| InChI | InChI=1S/C11H13BrN2S/c1-3-7-5-8(12)6-9-10(7)14-11(15-9)13-4-2/h5-6H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | ZAUIVBKPALVEQH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |