C14H18Cl2N2O2 — CID 82553818
(4,5-dichloro-2-propoxyphenyl)-piperazin-1-ylmethanone (PubChem CID 82553818) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is (4,5-dichloro-2-propoxyphenyl)-piperazin-1-ylmethanone.
| Compound Name | (4,5-dichloro-2-propoxyphenyl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 82553818 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (4,5-dichloro-2-propoxyphenyl)-piperazin-1-ylmethanone |
| SMILES | CCCOc1cc(Cl)c(Cl)cc1C(=O)N1CCNCC1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-2-7-20-13-9-12(16)11(15)8-10(13)14(19)18-5-3-17-4-6-18/h8-9,17H,2-7H2,1H3 |
| InChIKey | LTVFHFHHEFAXTB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |