C11H10N6OS — CID 82554677
7-amino-3-[(2-aminophenyl)methyl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one (PubChem CID 82554677) has the molecular formula C11H10N6OS and a molecular weight of 274.31 g/mol. Its IUPAC name is 7-amino-3-[(2-aminophenyl)methyl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one.
| Compound Name | 7-amino-3-[(2-aminophenyl)methyl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 82554677 |
| Molecular Formula | C11H10N6OS |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 7-amino-3-[(2-aminophenyl)methyl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
| SMILES | Nc1nn2c(=O)c(Cc3ccccc3N)nnc2s1 |
| InChI | InChI=1S/C11H10N6OS/c12-7-4-2-1-3-6(7)5-8-9(18)17-11(15-14-8)19-10(13)16-17/h1-4H,5,12H2,(H2,13,16) |
| InChIKey | LESFBPZQMNLXHH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|