methyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate

C14H12N4O2 — CID 82556512

IUPACmethyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate
SMILESCOC(=O)c1cccc(-c2cccc3nc(N)nn23)c1
InChIInChI=1S/C14H12N4O2/c1-20-13(19)10-5-2-4-9(8-10)11-6-3-7-12-16-14(15)17-18(11)12/h2-8H,1H3,(H2,15,17)
InChIKeyUUIHVNKGNKIWRW-UHFFFAOYSA-N
MW268.28 g/mol
LogP1.77
Rot. Bonds2

About methyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate

methyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate (PubChem CID 82556512) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is methyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate.

Molecular Properties

Compound Namemethyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate
PubChem CID82556512
Molecular FormulaC14H12N4O2
Molecular Weight268.28 g/mol
Exact Mass268.10
IUPAC Namemethyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate
SMILESCOC(=O)c1cccc(-c2cccc3nc(N)nn23)c1
InChIInChI=1S/C14H12N4O2/c1-20-13(19)10-5-2-4-9(8-10)11-6-3-7-12-16-14(15)17-18(11)12/h2-8H,1H3,(H2,15,17)
InChIKeyUUIHVNKGNKIWRW-UHFFFAOYSA-N
XLogP1.77
TPSA82.51 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.28
LogP ≤ 51.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate?
The IUPAC name of methyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate (CID 82556512) is methyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate.
What is the SMILES notation for methyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate?
The canonical SMILES for methyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate is COC(=O)c1cccc(-c2cccc3nc(N)nn23)c1.
What is the InChIKey of methyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate?
The InChIKey is UUIHVNKGNKIWRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O2/c1-20-13(19)10-5-2-4-9(8-10)11-6-3-7-12-16-14(15)17-18(11)12/h2-8H,1H3,(H2,15,17).
What are the key properties of methyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate?
methyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate has a molecular weight of 268.28 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate is sourced from PubChem (CID 82556512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).