C13H14N4O2 — CID 82557041
3-(2-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)benzoic acid (PubChem CID 82557041) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-(2-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)benzoic acid.
| Compound Name | 3-(2-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)benzoic acid |
|---|---|
| PubChem CID | 82557041 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 3-(2-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)benzoic acid |
| SMILES | Nc1nc2n(n1)CCCC2c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C13H14N4O2/c14-13-15-11-10(5-2-6-17(11)16-13)8-3-1-4-9(7-8)12(18)19/h1,3-4,7,10H,2,5-6H2,(H2,14,16)(H,18,19) |
| InChIKey | FWIZBMVFXOMPKD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |