C13H15FN4 — CID 82557324
6-(3-fluorophenyl)-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 82557324) has the molecular formula C13H15FN4 and a molecular weight of 246.29 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 6-(3-fluorophenyl)-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 82557324 |
| Molecular Formula | C13H15FN4 |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 6-(3-fluorophenyl)-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CC1Cc2nc(N)nn2CC1c1cccc(F)c1 |
| InChI | InChI=1S/C13H15FN4/c1-8-5-12-16-13(15)17-18(12)7-11(8)9-3-2-4-10(14)6-9/h2-4,6,8,11H,5,7H2,1H3,(H2,15,17) |
| InChIKey | WTNCTRUEGYLJFS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |