C14H16N4O2 — CID 82557377
4-(2-amino-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)benzoic acid (PubChem CID 82557377) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-(2-amino-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)benzoic acid.
| Compound Name | 4-(2-amino-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)benzoic acid |
|---|---|
| PubChem CID | 82557377 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4-(2-amino-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)benzoic acid |
| SMILES | CC1Cc2nc(N)nn2CC1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C14H16N4O2/c1-8-6-12-16-14(15)17-18(12)7-11(8)9-2-4-10(5-3-9)13(19)20/h2-5,8,11H,6-7H2,1H3,(H2,15,17)(H,19,20) |
| InChIKey | PWCIMKNDKMKMOS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |