C6H9BrN4 — CID 70666179
7-bromo-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 70666179) has the molecular formula C6H9BrN4 and a molecular weight of 217.07 g/mol. Its IUPAC name is 7-bromo-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 7-bromo-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 70666179 |
| Molecular Formula | C6H9BrN4 |
| Molecular Weight | 217.07 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | 7-bromo-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Nc1nc2n(n1)CCC(Br)C2 |
| InChI | InChI=1S/C6H9BrN4/c7-4-1-2-11-5(3-4)9-6(8)10-11/h4H,1-3H2,(H2,8,10) |
| InChIKey | VYNFKINWHMLLGK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.07 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|