C8H11N3O — CID 83873319
7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-2-carbaldehyde (PubChem CID 83873319) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-2-carbaldehyde.
| Compound Name | 7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 83873319 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-2-carbaldehyde |
| SMILES | CC1CCn2nc(C=O)nc2C1 |
| InChI | InChI=1S/C8H11N3O/c1-6-2-3-11-8(4-6)9-7(5-12)10-11/h5-6H,2-4H2,1H3 |
| InChIKey | WMHLSPNNWARGRJ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|