C12H19N3O2S — CID 117156702
2-[(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methyl]thiolane 1,1-dioxide (PubChem CID 117156702) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-[(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methyl]thiolane 1,1-dioxide.
| Compound Name | 2-[(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 117156702 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-[(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methyl]thiolane 1,1-dioxide |
| SMILES | CC1CCn2nc(CC3CCCS3(=O)=O)nc2C1 |
| InChI | InChI=1S/C12H19N3O2S/c1-9-4-5-15-12(7-9)13-11(14-15)8-10-3-2-6-18(10,16)17/h9-10H,2-8H2,1H3 |
| InChIKey | BHIJSEUPUYRXMM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |