C14H15FN4O3 — CID 82557548
2-amino-6-(3-fluoro-4-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid (PubChem CID 82557548) has the molecular formula C14H15FN4O3 and a molecular weight of 306.30 g/mol. Its IUPAC name is 2-amino-6-(3-fluoro-4-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid.
| Compound Name | 2-amino-6-(3-fluoro-4-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid |
|---|---|
| PubChem CID | 82557548 |
| Molecular Formula | C14H15FN4O3 |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-amino-6-(3-fluoro-4-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid |
| SMILES | COc1ccc(C2Cn3nc(N)nc3CC2C(=O)O)cc1F |
| InChI | InChI=1S/C14H15FN4O3/c1-22-11-3-2-7(4-10(11)15)9-6-19-12(17-14(16)18-19)5-8(9)13(20)21/h2-4,8-9H,5-6H2,1H3,(H2,16,18)(H,20,21) |
| InChIKey | HQLJOSULSORFCQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |