C17H15Cl2N3 — CID 82558475
4-[[2-[(3,5-dichlorophenyl)methyl]imidazol-1-yl]methyl]aniline (PubChem CID 82558475) has the molecular formula C17H15Cl2N3 and a molecular weight of 332.23 g/mol. Its IUPAC name is 4-[[2-[(3,5-dichlorophenyl)methyl]imidazol-1-yl]methyl]aniline.
| Compound Name | 4-[[2-[(3,5-dichlorophenyl)methyl]imidazol-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 82558475 |
| Molecular Formula | C17H15Cl2N3 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 4-[[2-[(3,5-dichlorophenyl)methyl]imidazol-1-yl]methyl]aniline |
| SMILES | Nc1ccc(Cn2ccnc2Cc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C17H15Cl2N3/c18-14-7-13(8-15(19)10-14)9-17-21-5-6-22(17)11-12-1-3-16(20)4-2-12/h1-8,10H,9,11,20H2 |
| InChIKey | LORFXSFWIQPBEE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|