C18H17BrClN3 — CID 82558528
[4-[[2-[(3-bromo-5-chlorophenyl)methyl]imidazol-1-yl]methyl]phenyl]methanamine (PubChem CID 82558528) has the molecular formula C18H17BrClN3 and a molecular weight of 390.71 g/mol. Its IUPAC name is [4-[[2-[(3-bromo-5-chlorophenyl)methyl]imidazol-1-yl]methyl]phenyl]methanamine.
| Compound Name | [4-[[2-[(3-bromo-5-chlorophenyl)methyl]imidazol-1-yl]methyl]phenyl]methanamine |
|---|---|
| PubChem CID | 82558528 |
| Molecular Formula | C18H17BrClN3 |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | [4-[[2-[(3-bromo-5-chlorophenyl)methyl]imidazol-1-yl]methyl]phenyl]methanamine |
| SMILES | NCc1ccc(Cn2ccnc2Cc2cc(Cl)cc(Br)c2)cc1 |
| InChI | InChI=1S/C18H17BrClN3/c19-16-7-15(8-17(20)10-16)9-18-22-5-6-23(18)12-14-3-1-13(11-21)2-4-14/h1-8,10H,9,11-12,21H2 |
| InChIKey | WCZUQPHZVCPISN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |