C13H12Cl2N2O2 — CID 82561099
methyl 2-[2-[(3,5-dichlorophenyl)methyl]imidazol-1-yl]acetate (PubChem CID 82561099) has the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.16 g/mol. Its IUPAC name is methyl 2-[2-[(3,5-dichlorophenyl)methyl]imidazol-1-yl]acetate.
| Compound Name | methyl 2-[2-[(3,5-dichlorophenyl)methyl]imidazol-1-yl]acetate |
|---|---|
| PubChem CID | 82561099 |
| Molecular Formula | C13H12Cl2N2O2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | methyl 2-[2-[(3,5-dichlorophenyl)methyl]imidazol-1-yl]acetate |
| SMILES | COC(=O)Cn1ccnc1Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H12Cl2N2O2/c1-19-13(18)8-17-3-2-16-12(17)6-9-4-10(14)7-11(15)5-9/h2-5,7H,6,8H2,1H3 |
| InChIKey | XWMHHHWCIHKCKJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |