C13H11N5O3S — CID 82562479
ethyl 8-carbamothioyl-2-oxo-1H-[1,2,4]triazino[2,3-a]benzimidazole-3-carboxylate (PubChem CID 82562479) has the molecular formula C13H11N5O3S and a molecular weight of 317.33 g/mol. Its IUPAC name is ethyl 8-carbamothioyl-2-oxo-1H-[1,2,4]triazino[2,3-a]benzimidazole-3-carboxylate.
| Compound Name | ethyl 8-carbamothioyl-2-oxo-1H-[1,2,4]triazino[2,3-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 82562479 |
| Molecular Formula | C13H11N5O3S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | ethyl 8-carbamothioyl-2-oxo-1H-[1,2,4]triazino[2,3-a]benzimidazole-3-carboxylate |
| SMILES | CCOC(=O)c1nc2nc3ccc(C(N)=S)cc3n2[nH]c1=O |
| InChI | InChI=1S/C13H11N5O3S/c1-2-21-12(20)9-11(19)17-18-8-5-6(10(14)22)3-4-7(8)15-13(18)16-9/h3-5H,2H2,1H3,(H2,14,22)(H,17,19) |
| InChIKey | FSAZRWAMDGTRBH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|