C16H11ClFN5O2 — CID 82563839
N-(3-chloro-4-fluorophenyl)-4,7-dioxa-11,12,14,16-tetrazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3(8),9,13,15-pentaen-13-amine (PubChem CID 82563839) has the molecular formula C16H11ClFN5O2 and a molecular weight of 359.75 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4,7-dioxa-11,12,14,16-tetrazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3(8),9,13,15-pentaen-13-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4,7-dioxa-11,12,14,16-tetrazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3(8),9,13,15-pentaen-13-amine |
|---|---|
| PubChem CID | 82563839 |
| Molecular Formula | C16H11ClFN5O2 |
| Molecular Weight | 359.75 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4,7-dioxa-11,12,14,16-tetrazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3(8),9,13,15-pentaen-13-amine |
| SMILES | Fc1ccc(Nc2nc3nc4cc5c(cc4n3[nH]2)OCCO5)cc1Cl |
| InChI | InChI=1S/C16H11ClFN5O2/c17-9-5-8(1-2-10(9)18)19-15-21-16-20-11-6-13-14(25-4-3-24-13)7-12(11)23(16)22-15/h1-2,5-7H,3-4H2,(H2,19,20,21,22) |
| InChIKey | BYXIDRVXIKQMFR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.75 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |