C15H10FN5O2 — CID 82563753
N-(2-fluorophenyl)-4,6-dioxa-10,11,13,15-tetrazatetracyclo[7.6.0.03,7.010,14]pentadeca-1,3(7),8,12,14-pentaen-12-amine (PubChem CID 82563753) has the molecular formula C15H10FN5O2 and a molecular weight of 311.28 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4,6-dioxa-10,11,13,15-tetrazatetracyclo[7.6.0.03,7.010,14]pentadeca-1,3(7),8,12,14-pentaen-12-amine.
| Compound Name | N-(2-fluorophenyl)-4,6-dioxa-10,11,13,15-tetrazatetracyclo[7.6.0.03,7.010,14]pentadeca-1,3(7),8,12,14-pentaen-12-amine |
|---|---|
| PubChem CID | 82563753 |
| Molecular Formula | C15H10FN5O2 |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-(2-fluorophenyl)-4,6-dioxa-10,11,13,15-tetrazatetracyclo[7.6.0.03,7.010,14]pentadeca-1,3(7),8,12,14-pentaen-12-amine |
| SMILES | Fc1ccccc1Nc1nc2nc3cc4c(cc3n2[nH]1)OCO4 |
| InChI | InChI=1S/C15H10FN5O2/c16-8-3-1-2-4-9(8)17-14-19-15-18-10-5-12-13(23-7-22-12)6-11(10)21(15)20-14/h1-6H,7H2,(H2,17,18,19,20) |
| InChIKey | RXTWGYJQGMTQME-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |