C17H34N4 — CID 82565018
1-[4-(azepan-1-ylmethyl)piperidin-3-yl]-1,4-diazepane (PubChem CID 82565018) has the molecular formula C17H34N4 and a molecular weight of 294.49 g/mol. Its IUPAC name is 1-[4-(azepan-1-ylmethyl)piperidin-3-yl]-1,4-diazepane.
| Compound Name | 1-[4-(azepan-1-ylmethyl)piperidin-3-yl]-1,4-diazepane |
|---|---|
| PubChem CID | 82565018 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | 1-[4-(azepan-1-ylmethyl)piperidin-3-yl]-1,4-diazepane |
| SMILES | C1CCCN(CC2CCNCC2N2CCCNCC2)CC1 |
| InChI | InChI=1S/C17H34N4/c1-2-4-11-20(10-3-1)15-16-6-8-19-14-17(16)21-12-5-7-18-9-13-21/h16-19H,1-15H2 |
| InChIKey | ZDJOXPYVXZPHQL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |