About 2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid
2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid (PubChem CID 82565546) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid.
Analyze 2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid?
The IUPAC name of 2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid (CID 82565546) is 2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid.
What is the SMILES notation for 2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid?
The canonical SMILES for 2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid is CC(C)(C)c1nc2c(C(=O)O)cccn2n1.
What is the InChIKey of 2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid?
The InChIKey is FPAGSVBUGLIOFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c1-11(2,3)10-12-8-7(9(15)16)5-4-6-14(8)13-10/h4-6H,1-3H3,(H,15,16).
What are the key properties of 2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid?
2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid has a molecular weight of 219.24 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid is sourced from PubChem (CID 82565546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).