2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid

C12H8N4O2 — CID 82565551

IUPAC2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid
SMILESO=C(O)c1cccn2nc(-c3cccnc3)nc12
InChIInChI=1S/C12H8N4O2/c17-12(18)9-4-2-6-16-11(9)14-10(15-16)8-3-1-5-13-7-8/h1-7H,(H,17,18)
InChIKeyZZMIOSCQUDPUTQ-UHFFFAOYSA-N
MW240.22 g/mol
LogP1.49
Rot. Bonds2

About 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid

2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid (PubChem CID 82565551) has the molecular formula C12H8N4O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid.

Molecular Properties

Compound Name2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid
PubChem CID82565551
Molecular FormulaC12H8N4O2
Molecular Weight240.22 g/mol
Exact Mass240.06
IUPAC Name2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid
SMILESO=C(O)c1cccn2nc(-c3cccnc3)nc12
InChIInChI=1S/C12H8N4O2/c17-12(18)9-4-2-6-16-11(9)14-10(15-16)8-3-1-5-13-7-8/h1-7H,(H,17,18)
InChIKeyZZMIOSCQUDPUTQ-UHFFFAOYSA-N
XLogP1.49
TPSA80.38 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.22
LogP ≤ 51.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid?
The IUPAC name of 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid (CID 82565551) is 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid.
What is the SMILES notation for 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid?
The canonical SMILES for 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid is O=C(O)c1cccn2nc(-c3cccnc3)nc12.
What is the InChIKey of 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid?
The InChIKey is ZZMIOSCQUDPUTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O2/c17-12(18)9-4-2-6-16-11(9)14-10(15-16)8-3-1-5-13-7-8/h1-7H,(H,17,18).
What are the key properties of 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid?
2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid has a molecular weight of 240.22 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid is sourced from PubChem (CID 82565551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).