C11H15N5O — CID 82565906
2-(2-methoxyethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide (PubChem CID 82565906) has the molecular formula C11H15N5O and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide.
| Compound Name | 2-(2-methoxyethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide |
|---|---|
| PubChem CID | 82565906 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 2-(2-methoxyethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C)n2nc(CCOC)nc12 |
| InChI | InChI=1S/C11H15N5O/c1-7-3-4-8(10(12)13)11-14-9(5-6-17-2)15-16(7)11/h3-4H,5-6H2,1-2H3,(H3,12,13) |
| InChIKey | NBXFQPJPPIJATQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|