C12H18N6 — CID 82565908
2-[2-(dimethylamino)ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide (PubChem CID 82565908) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide.
| Compound Name | 2-[2-(dimethylamino)ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide |
|---|---|
| PubChem CID | 82565908 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C)n2nc(CCN(C)C)nc12 |
| InChI | InChI=1S/C12H18N6/c1-8-4-5-9(11(13)14)12-15-10(16-18(8)12)6-7-17(2)3/h4-5H,6-7H2,1-3H3,(H3,13,14) |
| InChIKey | ASPBSXPUXZSGFE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|