C18H13FN6 — CID 82565927
2-(4-fluorophenyl)-5-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide (PubChem CID 82565927) has the molecular formula C18H13FN6 and a molecular weight of 332.34 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide.
| Compound Name | 2-(4-fluorophenyl)-5-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide |
|---|---|
| PubChem CID | 82565927 |
| Molecular Formula | C18H13FN6 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-(4-fluorophenyl)-5-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccncc2)n2nc(-c3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C18H13FN6/c19-13-3-1-12(2-4-13)17-23-18-14(16(20)21)5-6-15(25(18)24-17)11-7-9-22-10-8-11/h1-10H,(H3,20,21) |
| InChIKey | KDYJJRYAZMPZNF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|