C19H13BrClN5 — CID 82565974
5-(3-bromophenyl)-2-(3-chlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide (PubChem CID 82565974) has the molecular formula C19H13BrClN5 and a molecular weight of 426.71 g/mol. Its IUPAC name is 5-(3-bromophenyl)-2-(3-chlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide.
| Compound Name | 5-(3-bromophenyl)-2-(3-chlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide |
|---|---|
| PubChem CID | 82565974 |
| Molecular Formula | C19H13BrClN5 |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 5-(3-bromophenyl)-2-(3-chlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2cccc(Br)c2)n2nc(-c3cccc(Cl)c3)nc12 |
| InChI | InChI=1S/C19H13BrClN5/c20-13-5-1-3-11(9-13)16-8-7-15(17(22)23)19-24-18(25-26(16)19)12-4-2-6-14(21)10-12/h1-10H,(H3,22,23) |
| InChIKey | FGDLKNBVGYPREX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|