C13H10BrN5 — CID 82565961
5-(3-bromophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide (PubChem CID 82565961) has the molecular formula C13H10BrN5 and a molecular weight of 316.16 g/mol. Its IUPAC name is 5-(3-bromophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide.
| Compound Name | 5-(3-bromophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide |
|---|---|
| PubChem CID | 82565961 |
| Molecular Formula | C13H10BrN5 |
| Molecular Weight | 316.16 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 5-(3-bromophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2cccc(Br)c2)n2ncnc12 |
| InChI | InChI=1S/C13H10BrN5/c14-9-3-1-2-8(6-9)11-5-4-10(12(15)16)13-17-7-18-19(11)13/h1-7H,(H3,15,16) |
| InChIKey | BDVURDOYDAXFQP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.16 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|