C16H17N3O2 — CID 82518505
1-cyclopropyl-6-(3-methoxyphenyl)-2-oxopyridine-3-carboximidamide (PubChem CID 82518505) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-cyclopropyl-6-(3-methoxyphenyl)-2-oxopyridine-3-carboximidamide.
| Compound Name | 1-cyclopropyl-6-(3-methoxyphenyl)-2-oxopyridine-3-carboximidamide |
|---|---|
| PubChem CID | 82518505 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 1-cyclopropyl-6-(3-methoxyphenyl)-2-oxopyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2cccc(OC)c2)n(C2CC2)c1=O |
| InChI | InChI=1S/C16H17N3O2/c1-21-12-4-2-3-10(9-12)14-8-7-13(15(17)18)16(20)19(14)11-5-6-11/h2-4,7-9,11H,5-6H2,1H3,(H3,17,18) |
| InChIKey | WINRIIFDIIWEAM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|