C23H32N2O2 — CID 145460869
1-cyclopropyl-1-[3-(3-methoxyphenyl)phenyl]propan-2-one;ethane;ethanimidamide (PubChem CID 145460869) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-cyclopropyl-1-[3-(3-methoxyphenyl)phenyl]propan-2-one;ethane;ethanimidamide.
| Compound Name | 1-cyclopropyl-1-[3-(3-methoxyphenyl)phenyl]propan-2-one;ethane;ethanimidamide |
|---|---|
| PubChem CID | 145460869 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 1-cyclopropyl-1-[3-(3-methoxyphenyl)phenyl]propan-2-one;ethane;ethanimidamide |
| SMILES | CC.COc1cccc(-c2cccc(C(C(C)=O)C3CC3)c2)c1.[H]/N=C(\C)N |
| InChI | InChI=1S/C19H20O2.C2H6N2.C2H6/c1-13(20)19(14-9-10-14)17-7-3-5-15(11-17)16-6-4-8-18(12-16)21-2;1-2(3)4;1-2/h3-8,11-12,14,19H,9-10H2,1-2H3;1H3,(H3,3,4);1-2H3 |
| InChIKey | PUKXWSZWXDTKGJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|