C12H13BrN6 — CID 114904625
4-bromo-2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)benzenecarboximidamide (PubChem CID 114904625) has the molecular formula C12H13BrN6 and a molecular weight of 321.18 g/mol. Its IUPAC name is 4-bromo-2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)benzenecarboximidamide.
| Compound Name | 4-bromo-2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 114904625 |
| Molecular Formula | C12H13BrN6 |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 4-bromo-2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Br)cc1N1CCn2cnnc2C1 |
| InChI | InChI=1S/C12H13BrN6/c13-8-1-2-9(12(14)15)10(5-8)18-3-4-19-7-16-17-11(19)6-18/h1-2,5,7H,3-4,6H2,(H3,14,15) |
| InChIKey | HJTAGBVMQPHQGG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|