About 2-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-fluorobenzenecarboximidamide
2-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-fluorobenzenecarboximidamide (PubChem CID 107536481) has the molecular formula C13H13BrFN5
and a molecular weight of 338.18 g/mol. Its IUPAC name is 2-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-fluorobenzenecarboximidamide.
Molecular Properties
| Compound Name | 2-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-fluorobenzenecarboximidamide |
| PubChem CID | 107536481 |
| Molecular Formula | C13H13BrFN5 |
| Molecular Weight | 338.18 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 2-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CCn3ccnc3C2)c(F)c1Br |
| InChI | InChI=1S/C13H13BrFN5/c14-11-8(13(16)17)1-2-9(12(11)15)20-6-5-19-4-3-18-10(19)7-20/h1-4H,5-7H2,(H3,16,17) |
| InChIKey | ZQSIKPFWCJUQAG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.18 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-fluorobenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-fluorobenzenecarboximidamide?
The IUPAC name of 2-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-fluorobenzenecarboximidamide (CID 107536481) is 2-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-fluorobenzenecarboximidamide.
What is the SMILES notation for 2-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-fluorobenzenecarboximidamide?
The canonical SMILES for 2-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-fluorobenzenecarboximidamide is [H]/N=C(\N)c1ccc(N2CCn3ccnc3C2)c(F)c1Br.
What is the InChIKey of 2-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-fluorobenzenecarboximidamide?
The InChIKey is ZQSIKPFWCJUQAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrFN5/c14-11-8(13(16)17)1-2-9(12(11)15)20-6-5-19-4-3-18-10(19)7-20/h1-4H,5-7H2,(H3,16,17).
What are the key properties of 2-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-fluorobenzenecarboximidamide?
2-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-fluorobenzenecarboximidamide has a molecular weight of 338.18 g/mol, XLogP of 2.09, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-fluorobenzenecarboximidamide is sourced from PubChem (CID 107536481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).