C14H20BrFN4 — CID 107536335
2-bromo-4-[4-(dimethylamino)piperidin-1-yl]-3-fluorobenzenecarboximidamide (PubChem CID 107536335) has the molecular formula C14H20BrFN4 and a molecular weight of 343.24 g/mol. Its IUPAC name is 2-bromo-4-[4-(dimethylamino)piperidin-1-yl]-3-fluorobenzenecarboximidamide.
| Compound Name | 2-bromo-4-[4-(dimethylamino)piperidin-1-yl]-3-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 107536335 |
| Molecular Formula | C14H20BrFN4 |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-bromo-4-[4-(dimethylamino)piperidin-1-yl]-3-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CCC(N(C)C)CC2)c(F)c1Br |
| InChI | InChI=1S/C14H20BrFN4/c1-19(2)9-5-7-20(8-6-9)11-4-3-10(14(17)18)12(15)13(11)16/h3-4,9H,5-8H2,1-2H3,(H3,17,18) |
| InChIKey | QABDAXALSYUIFQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|