C19H12BrClN4S — CID 82565824
5-(3-bromophenyl)-2-(3-chlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide (PubChem CID 82565824) has the molecular formula C19H12BrClN4S and a molecular weight of 443.76 g/mol. Its IUPAC name is 5-(3-bromophenyl)-2-(3-chlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide.
| Compound Name | 5-(3-bromophenyl)-2-(3-chlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide |
|---|---|
| PubChem CID | 82565824 |
| Molecular Formula | C19H12BrClN4S |
| Molecular Weight | 443.76 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | 5-(3-bromophenyl)-2-(3-chlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide |
| SMILES | NC(=S)c1ccc(-c2cccc(Br)c2)n2nc(-c3cccc(Cl)c3)nc12 |
| InChI | InChI=1S/C19H12BrClN4S/c20-13-5-1-3-11(9-13)16-8-7-15(17(22)26)19-23-18(24-25(16)19)12-4-2-6-14(21)10-12/h1-10H,(H2,22,26) |
| InChIKey | JPNSBSWVZCLYMM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.76 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|