C14H8BrClN4 — CID 82565369
5-(3-bromophenyl)-2-(chloromethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile (PubChem CID 82565369) has the molecular formula C14H8BrClN4 and a molecular weight of 347.60 g/mol. Its IUPAC name is 5-(3-bromophenyl)-2-(chloromethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile.
| Compound Name | 5-(3-bromophenyl)-2-(chloromethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile |
|---|---|
| PubChem CID | 82565369 |
| Molecular Formula | C14H8BrClN4 |
| Molecular Weight | 347.60 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 5-(3-bromophenyl)-2-(chloromethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile |
| SMILES | N#Cc1ccc(-c2cccc(Br)c2)n2nc(CCl)nc12 |
| InChI | InChI=1S/C14H8BrClN4/c15-11-3-1-2-9(6-11)12-5-4-10(8-17)14-18-13(7-16)19-20(12)14/h1-6H,7H2 |
| InChIKey | DCIYIVXLOFYGAA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.60 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|