C19H15N5O2 — CID 82565479
methyl 2-(4-aminophenyl)-5-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate (PubChem CID 82565479) has the molecular formula C19H15N5O2 and a molecular weight of 345.36 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-5-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate.
| Compound Name | methyl 2-(4-aminophenyl)-5-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 82565479 |
| Molecular Formula | C19H15N5O2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | methyl 2-(4-aminophenyl)-5-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate |
| SMILES | COC(=O)c1ccc(-c2ccncc2)n2nc(-c3ccc(N)cc3)nc12 |
| InChI | InChI=1S/C19H15N5O2/c1-26-19(25)15-6-7-16(12-8-10-21-11-9-12)24-18(15)22-17(23-24)13-2-4-14(20)5-3-13/h2-11H,20H2,1H3 |
| InChIKey | APHFKWZLWXGONJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|