C20H16N4O2 — CID 82565449
methyl 2-(4-aminophenyl)-6-phenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate (PubChem CID 82565449) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-6-phenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate.
| Compound Name | methyl 2-(4-aminophenyl)-6-phenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 82565449 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | methyl 2-(4-aminophenyl)-6-phenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)cn2nc(-c3ccc(N)cc3)nc12 |
| InChI | InChI=1S/C20H16N4O2/c1-26-20(25)17-11-15(13-5-3-2-4-6-13)12-24-19(17)22-18(23-24)14-7-9-16(21)10-8-14/h2-12H,21H2,1H3 |
| InChIKey | YZYIKOBDTZWMMU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|