C15H21N5 — CID 82557818
2-[[2-[2-(dimethylamino)ethyl]imidazol-1-yl]methyl]benzenecarboximidamide (PubChem CID 82557818) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 2-[[2-[2-(dimethylamino)ethyl]imidazol-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 2-[[2-[2-(dimethylamino)ethyl]imidazol-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 82557818 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 2-[[2-[2-(dimethylamino)ethyl]imidazol-1-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1Cn1ccnc1CCN(C)C |
| InChI | InChI=1S/C15H21N5/c1-19(2)9-7-14-18-8-10-20(14)11-12-5-3-4-6-13(12)15(16)17/h3-6,8,10H,7,9,11H2,1-2H3,(H3,16,17) |
| InChIKey | DZTQHUXVNPCDJQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|