C18H16F2N4 — CID 82558374
2-[[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]methyl]benzenecarboximidamide (PubChem CID 82558374) has the molecular formula C18H16F2N4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-[[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 2-[[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 82558374 |
| Molecular Formula | C18H16F2N4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1Cn1ccnc1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C18H16F2N4/c19-14-6-5-12(16(20)10-14)9-17-23-7-8-24(17)11-13-3-1-2-4-15(13)18(21)22/h1-8,10H,9,11H2,(H3,21,22) |
| InChIKey | UKJCNFMADQYFTH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|