C15H20N4O2 — CID 82569152
2-[3-(3,4-dimethoxyphenyl)-1H-1,2,4-triazol-5-yl]piperidine (PubChem CID 82569152) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[3-(3,4-dimethoxyphenyl)-1H-1,2,4-triazol-5-yl]piperidine.
| Compound Name | 2-[3-(3,4-dimethoxyphenyl)-1H-1,2,4-triazol-5-yl]piperidine |
|---|---|
| PubChem CID | 82569152 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-[3-(3,4-dimethoxyphenyl)-1H-1,2,4-triazol-5-yl]piperidine |
| SMILES | COc1ccc(-c2n[nH]c(C3CCCCN3)n2)cc1OC |
| InChI | InChI=1S/C15H20N4O2/c1-20-12-7-6-10(9-13(12)21-2)14-17-15(19-18-14)11-5-3-4-8-16-11/h6-7,9,11,16H,3-5,8H2,1-2H3,(H,17,18,19) |
| InChIKey | LOMQKTAIVPLCGE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |