C14H19N3 — CID 82572376
7-ethyl-1-N,1-N,4-N-trimethylisoquinoline-1,4-diamine (PubChem CID 82572376) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 7-ethyl-1-N,1-N,4-N-trimethylisoquinoline-1,4-diamine.
| Compound Name | 7-ethyl-1-N,1-N,4-N-trimethylisoquinoline-1,4-diamine |
|---|---|
| PubChem CID | 82572376 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 7-ethyl-1-N,1-N,4-N-trimethylisoquinoline-1,4-diamine |
| SMILES | CCc1ccc2c(NC)cnc(N(C)C)c2c1 |
| InChI | InChI=1S/C14H19N3/c1-5-10-6-7-11-12(8-10)14(17(3)4)16-9-13(11)15-2/h6-9,15H,5H2,1-4H3 |
| InChIKey | QVNDQELTGLXJAY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |