C10H15FN2 — CID 90883048
4-ethyl-2-N-fluoro-1-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 90883048) has the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. Its IUPAC name is 4-ethyl-2-N-fluoro-1-N,2-N-dimethylbenzene-1,2-diamine.
| Compound Name | 4-ethyl-2-N-fluoro-1-N,2-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 90883048 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 4-ethyl-2-N-fluoro-1-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | CCc1ccc(NC)c(N(C)F)c1 |
| InChI | InChI=1S/C10H15FN2/c1-4-8-5-6-9(12-2)10(7-8)13(3)11/h5-7,12H,4H2,1-3H3 |
| InChIKey | ZOPNFHBZOOHKSV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|