C12H20N2O — CID 115226672
N'-(5-ethyl-2-methoxyphenyl)-N,N'-dimethylmethanediamine (PubChem CID 115226672) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is N'-(5-ethyl-2-methoxyphenyl)-N,N'-dimethylmethanediamine.
| Compound Name | N'-(5-ethyl-2-methoxyphenyl)-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 115226672 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N'-(5-ethyl-2-methoxyphenyl)-N,N'-dimethylmethanediamine |
| SMILES | CCc1ccc(OC)c(N(C)CNC)c1 |
| InChI | InChI=1S/C12H20N2O/c1-5-10-6-7-12(15-4)11(8-10)14(3)9-13-2/h6-8,13H,5,9H2,1-4H3 |
| InChIKey | ZHAASKGJIZFHDJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|