C12H20N2O3 — CID 115226740
N,N'-dimethyl-N'-(2,4,5-trimethoxyphenyl)methanediamine (PubChem CID 115226740) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is N,N'-dimethyl-N'-(2,4,5-trimethoxyphenyl)methanediamine.
| Compound Name | N,N'-dimethyl-N'-(2,4,5-trimethoxyphenyl)methanediamine |
|---|---|
| PubChem CID | 115226740 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | N,N'-dimethyl-N'-(2,4,5-trimethoxyphenyl)methanediamine |
| SMILES | CNCN(C)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C12H20N2O3/c1-13-8-14(2)9-6-11(16-4)12(17-5)7-10(9)15-3/h6-7,13H,8H2,1-5H3 |
| InChIKey | LLXOVZVCMIMKPI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|