C11H17ClN2O — CID 115226674
N'-(5-chloro-4-methoxy-2-methylphenyl)-N,N'-dimethylmethanediamine (PubChem CID 115226674) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is N'-(5-chloro-4-methoxy-2-methylphenyl)-N,N'-dimethylmethanediamine.
| Compound Name | N'-(5-chloro-4-methoxy-2-methylphenyl)-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 115226674 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N'-(5-chloro-4-methoxy-2-methylphenyl)-N,N'-dimethylmethanediamine |
| SMILES | CNCN(C)c1cc(Cl)c(OC)cc1C |
| InChI | InChI=1S/C11H17ClN2O/c1-8-5-11(15-4)9(12)6-10(8)14(3)7-13-2/h5-6,13H,7H2,1-4H3 |
| InChIKey | LPJALCYVOMPLFQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|