C12H15N3 — CID 82572766
1-N,1-N,7-N-trimethylisoquinoline-1,7-diamine (PubChem CID 82572766) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-N,1-N,7-N-trimethylisoquinoline-1,7-diamine.
| Compound Name | 1-N,1-N,7-N-trimethylisoquinoline-1,7-diamine |
|---|---|
| PubChem CID | 82572766 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 1-N,1-N,7-N-trimethylisoquinoline-1,7-diamine |
| SMILES | CNc1ccc2ccnc(N(C)C)c2c1 |
| InChI | InChI=1S/C12H15N3/c1-13-10-5-4-9-6-7-14-12(15(2)3)11(9)8-10/h4-8,13H,1-3H3 |
| InChIKey | HITFCYILVWEZSO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |