C13H10Cl3NO2 — CID 82575199
methyl 2-(5,6,8-trichloro-2-methylquinolin-4-yl)acetate (PubChem CID 82575199) has the molecular formula C13H10Cl3NO2 and a molecular weight of 318.59 g/mol. Its IUPAC name is methyl 2-(5,6,8-trichloro-2-methylquinolin-4-yl)acetate.
| Compound Name | methyl 2-(5,6,8-trichloro-2-methylquinolin-4-yl)acetate |
|---|---|
| PubChem CID | 82575199 |
| Molecular Formula | C13H10Cl3NO2 |
| Molecular Weight | 318.59 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | methyl 2-(5,6,8-trichloro-2-methylquinolin-4-yl)acetate |
| SMILES | COC(=O)Cc1cc(C)nc2c(Cl)cc(Cl)c(Cl)c12 |
| InChI | InChI=1S/C13H10Cl3NO2/c1-6-3-7(4-10(18)19-2)11-12(16)8(14)5-9(15)13(11)17-6/h3,5H,4H2,1-2H3 |
| InChIKey | VJOURGPGSJSYRH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|