C14H15F3N2 — CID 82577585
1-[2-methyl-5-(trifluoromethyl)quinolin-4-yl]propan-2-amine (PubChem CID 82577585) has the molecular formula C14H15F3N2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 1-[2-methyl-5-(trifluoromethyl)quinolin-4-yl]propan-2-amine.
| Compound Name | 1-[2-methyl-5-(trifluoromethyl)quinolin-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 82577585 |
| Molecular Formula | C14H15F3N2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-[2-methyl-5-(trifluoromethyl)quinolin-4-yl]propan-2-amine |
| SMILES | Cc1cc(CC(C)N)c2c(C(F)(F)F)cccc2n1 |
| InChI | InChI=1S/C14H15F3N2/c1-8(18)6-10-7-9(2)19-12-5-3-4-11(13(10)12)14(15,16)17/h3-5,7-8H,6,18H2,1-2H3 |
| InChIKey | DARDXMDILHXILJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |