C20H19F3N2 — CID 175944503
2-methyl-N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]quinolin-4-amine (PubChem CID 175944503) has the molecular formula C20H19F3N2 and a molecular weight of 344.38 g/mol. Its IUPAC name is 2-methyl-N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]quinolin-4-amine.
| Compound Name | 2-methyl-N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]quinolin-4-amine |
|---|---|
| PubChem CID | 175944503 |
| Molecular Formula | C20H19F3N2 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-methyl-N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]quinolin-4-amine |
| SMILES | Cc1cc(NC(C)c2cccc(C(F)(F)F)c2C)c2ccccc2n1 |
| InChI | InChI=1S/C20H19F3N2/c1-12-11-19(16-7-4-5-10-18(16)24-12)25-14(3)15-8-6-9-17(13(15)2)20(21,22)23/h4-11,14H,1-3H3,(H,24,25) |
| InChIKey | BMZPJNNURSFIRO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |