C18H16F3N3 — CID 170158881
N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]phthalazin-1-amine (PubChem CID 170158881) has the molecular formula C18H16F3N3 and a molecular weight of 331.34 g/mol. Its IUPAC name is N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]phthalazin-1-amine.
| Compound Name | N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]phthalazin-1-amine |
|---|---|
| PubChem CID | 170158881 |
| Molecular Formula | C18H16F3N3 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]phthalazin-1-amine |
| SMILES | Cc1c(C(C)Nc2nncc3ccccc23)cccc1C(F)(F)F |
| InChI | InChI=1S/C18H16F3N3/c1-11-14(8-5-9-16(11)18(19,20)21)12(2)23-17-15-7-4-3-6-13(15)10-22-24-17/h3-10,12H,1-2H3,(H,23,24) |
| InChIKey | MLOXXFZLYSHBNK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |