C15H12F3N5 — CID 175744236
N-[1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]phthalazin-1-amine (PubChem CID 175744236) has the molecular formula C15H12F3N5 and a molecular weight of 319.29 g/mol. Its IUPAC name is N-[1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]phthalazin-1-amine.
| Compound Name | N-[1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]phthalazin-1-amine |
|---|---|
| PubChem CID | 175744236 |
| Molecular Formula | C15H12F3N5 |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-[1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]phthalazin-1-amine |
| SMILES | CC(Nc1nncc2ccccc12)c1cnc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C15H12F3N5/c1-9(11-6-19-14(20-7-11)15(16,17)18)22-13-12-5-3-2-4-10(12)8-21-23-13/h2-9H,1H3,(H,22,23) |
| InChIKey | YFUNWIYSEMWPSK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |