C15H13NO2 — CID 82578547
9-amino-5-methyl-9H-fluorene-2-carboxylic acid (PubChem CID 82578547) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is 9-amino-5-methyl-9H-fluorene-2-carboxylic acid.
| Compound Name | 9-amino-5-methyl-9H-fluorene-2-carboxylic acid |
|---|---|
| PubChem CID | 82578547 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 9-amino-5-methyl-9H-fluorene-2-carboxylic acid |
| SMILES | Cc1cccc2c1-c1ccc(C(=O)O)cc1C2N |
| InChI | InChI=1S/C15H13NO2/c1-8-3-2-4-11-13(8)10-6-5-9(15(17)18)7-12(10)14(11)16/h2-7,14H,16H2,1H3,(H,17,18) |
| InChIKey | VGOXSBKRICENMP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |